C10H14F3NO — CID 171397520
[(2R,6S,8R)-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane]-8-yl]methanol (PubChem CID 171397520) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is [(2R,6S,8R)-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane]-8-yl]methanol.
| Compound Name | [(2R,6S,8R)-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane]-8-yl]methanol |
|---|---|
| PubChem CID | 171397520 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | [(2R,6S,8R)-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane]-8-yl]methanol |
| SMILES | OC[C@@]12C[C@@H](F)CN1C[C@@]1(CC1(F)F)C2 |
| InChI | InChI=1S/C10H14F3NO/c11-7-1-9(6-15)3-8(4-10(8,12)13)5-14(9)2-7/h7,15H,1-6H2/t7-,8+,9+/m1/s1 |
| InChIKey | OZTYJBZITNUBBM-VGMNWLOBSA-N |
| XLogP | 1.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |