C26H23ClN6O3 — CID 171399163
(2R,4S)-8-(3-chloro-2-methoxyanilino)-9-[2-(1-methylcyclopropyl)oxypyrido[3,2-d]pyrimidin-8-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one (PubChem CID 171399163) has the molecular formula C26H23ClN6O3 and a molecular weight of 502.96 g/mol. Its IUPAC name is (2R,4S)-8-(3-chloro-2-methoxyanilino)-9-[2-(1-methylcyclopropyl)oxypyrido[3,2-d]pyrimidin-8-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one.
| Compound Name | (2R,4S)-8-(3-chloro-2-methoxyanilino)-9-[2-(1-methylcyclopropyl)oxypyrido[3,2-d]pyrimidin-8-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
|---|---|
| PubChem CID | 171399163 |
| Molecular Formula | C26H23ClN6O3 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (2R,4S)-8-(3-chloro-2-methoxyanilino)-9-[2-(1-methylcyclopropyl)oxypyrido[3,2-d]pyrimidin-8-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccnc3cnc(OC4(C)CC4)nc23)[nH]c2c1C(=O)N[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C26H23ClN6O3/c1-26(7-8-26)36-25-29-11-17-19(33-25)12(6-9-28-17)21-22(30-15-5-3-4-14(27)23(15)35-2)18-20(32-21)13-10-16(13)31-24(18)34/h3-6,9,11,13,16,30,32H,7-8,10H2,1-2H3,(H,31,34)/t13-,16+/m1/s1 |
| InChIKey | DZQCGMRGACSTAV-CJNGLKHVSA-N |
| XLogP | 4.96 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |