C25H22FN5O2 — CID 171398831
(2S,4R)-8-(2-ethyl-3-fluoroanilino)-9-(6-methoxy-1,5-naphthyridin-4-yl)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one (PubChem CID 171398831) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is (2S,4R)-8-(2-ethyl-3-fluoroanilino)-9-(6-methoxy-1,5-naphthyridin-4-yl)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one.
| Compound Name | (2S,4R)-8-(2-ethyl-3-fluoroanilino)-9-(6-methoxy-1,5-naphthyridin-4-yl)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
|---|---|
| PubChem CID | 171398831 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2S,4R)-8-(2-ethyl-3-fluoroanilino)-9-(6-methoxy-1,5-naphthyridin-4-yl)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
| SMILES | CCc1c(F)cccc1Nc1c(-c2ccnc3ccc(OC)nc23)[nH]c2c1C(=O)N[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C25H22FN5O2/c1-3-12-15(26)5-4-6-16(12)28-24-20-22(14-11-18(14)29-25(20)32)31-23(24)13-9-10-27-17-7-8-19(33-2)30-21(13)17/h4-10,14,18,28,31H,3,11H2,1-2H3,(H,29,32)/t14-,18+/m0/s1 |
| InChIKey | HRRXHFRZAPZLAF-KBXCAEBGSA-N |
| XLogP | 4.68 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |