C27H24ClN5O4 — CID 171398952
(2S,4R)-8-(3-chloro-2-methoxyanilino)-9-[6-[(3R)-oxolan-3-yl]oxy-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one (PubChem CID 171398952) has the molecular formula C27H24ClN5O4 and a molecular weight of 517.97 g/mol. Its IUPAC name is (2S,4R)-8-(3-chloro-2-methoxyanilino)-9-[6-[(3R)-oxolan-3-yl]oxy-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one.
| Compound Name | (2S,4R)-8-(3-chloro-2-methoxyanilino)-9-[6-[(3R)-oxolan-3-yl]oxy-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
|---|---|
| PubChem CID | 171398952 |
| Molecular Formula | C27H24ClN5O4 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (2S,4R)-8-(3-chloro-2-methoxyanilino)-9-[6-[(3R)-oxolan-3-yl]oxy-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccnc3ccc(O[C@@H]4CCOC4)nc23)[nH]c2c1C(=O)N[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C27H24ClN5O4/c1-35-26-16(28)3-2-4-18(26)30-25-21-23(15-11-19(15)31-27(21)34)33-24(25)14-7-9-29-17-5-6-20(32-22(14)17)37-13-8-10-36-12-13/h2-7,9,13,15,19,30,33H,8,10-12H2,1H3,(H,31,34)/t13-,15+,19-/m1/s1 |
| InChIKey | IZEKEXOBMWQSCX-FRIZHTMISA-N |
| XLogP | 4.80 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |