C27H24ClN5O2 — CID 171398630
(2R,4S)-8-(3-chloro-2-methylanilino)-9-[6-(cyclopropylmethoxy)-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one (PubChem CID 171398630) has the molecular formula C27H24ClN5O2 and a molecular weight of 485.98 g/mol. Its IUPAC name is (2R,4S)-8-(3-chloro-2-methylanilino)-9-[6-(cyclopropylmethoxy)-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one.
| Compound Name | (2R,4S)-8-(3-chloro-2-methylanilino)-9-[6-(cyclopropylmethoxy)-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
|---|---|
| PubChem CID | 171398630 |
| Molecular Formula | C27H24ClN5O2 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (2R,4S)-8-(3-chloro-2-methylanilino)-9-[6-(cyclopropylmethoxy)-1,5-naphthyridin-4-yl]-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
| SMILES | Cc1c(Cl)cccc1Nc1c(-c2ccnc3ccc(OCC4CC4)nc23)[nH]c2c1C(=O)N[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C27H24ClN5O2/c1-13-17(28)3-2-4-18(13)30-26-22-24(16-11-20(16)31-27(22)34)33-25(26)15-9-10-29-19-7-8-21(32-23(15)19)35-12-14-5-6-14/h2-4,7-10,14,16,20,30,33H,5-6,11-12H2,1H3,(H,31,34)/t16-,20+/m1/s1 |
| InChIKey | XTHYKCOBTLZFTL-UZLBHIALSA-N |
| XLogP | 5.72 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |