C25H22FN5O2 — CID 171398610
(2R,5S)-9-(3-fluoro-2-methylanilino)-10-(6-methoxy-1,5-naphthyridin-4-yl)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one (PubChem CID 171398610) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is (2R,5S)-9-(3-fluoro-2-methylanilino)-10-(6-methoxy-1,5-naphthyridin-4-yl)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one.
| Compound Name | (2R,5S)-9-(3-fluoro-2-methylanilino)-10-(6-methoxy-1,5-naphthyridin-4-yl)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one |
|---|---|
| PubChem CID | 171398610 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2R,5S)-9-(3-fluoro-2-methylanilino)-10-(6-methoxy-1,5-naphthyridin-4-yl)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one |
| SMILES | COc1ccc2nccc(-c3[nH]c4c(c3Nc3cccc(F)c3C)C(=O)N[C@H]3CC[C@@H]43)c2n1 |
| InChI | InChI=1S/C25H22FN5O2/c1-12-15(26)4-3-5-16(12)28-24-20-22(13-6-7-17(13)29-25(20)32)31-23(24)14-10-11-27-18-8-9-19(33-2)30-21(14)18/h3-5,8-11,13,17,28,31H,6-7H2,1-2H3,(H,29,32)/t13-,17+/m1/s1 |
| InChIKey | QYYZYOMSXYAPKU-DYVFJYSZSA-N |
| XLogP | 4.81 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |