C15H25F2NO2 — CID 171400789
tert-butyl N-[(3,3-difluorocyclobutyl)methyl]-N-pent-4-enylcarbamate (PubChem CID 171400789) has the molecular formula C15H25F2NO2 and a molecular weight of 289.37 g/mol. Its IUPAC name is tert-butyl N-[(3,3-difluorocyclobutyl)methyl]-N-pent-4-enylcarbamate.
| Compound Name | tert-butyl N-[(3,3-difluorocyclobutyl)methyl]-N-pent-4-enylcarbamate |
|---|---|
| PubChem CID | 171400789 |
| Molecular Formula | C15H25F2NO2 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | tert-butyl N-[(3,3-difluorocyclobutyl)methyl]-N-pent-4-enylcarbamate |
| SMILES | C=CCCCN(CC1CC(F)(F)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25F2NO2/c1-5-6-7-8-18(13(19)20-14(2,3)4)11-12-9-15(16,17)10-12/h5,12H,1,6-11H2,2-4H3 |
| InChIKey | CHZXVWHHELZHHK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|