C25H30N4O5 — CID 171406991
5-[(2R)-4-(cyclohexanecarbonyl)-2-methylpiperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 171406991) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[(2R)-4-(cyclohexanecarbonyl)-2-methylpiperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[(2R)-4-(cyclohexanecarbonyl)-2-methylpiperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 171406991 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 5-[(2R)-4-(cyclohexanecarbonyl)-2-methylpiperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | C[C@@H]1CN(C(=O)C2CCCCC2)CCN1c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H30N4O5/c1-15-14-27(23(32)16-5-3-2-4-6-16)11-12-28(15)17-7-8-18-19(13-17)25(34)29(24(18)33)20-9-10-21(30)26-22(20)31/h7-8,13,15-16,20H,2-6,9-12,14H2,1H3,(H,26,30,31)/t15-,20?/m1/s1 |
| InChIKey | BWZVWMICVMLQFB-IWPPFLRJSA-N |
| XLogP | 1.71 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|