C17H10F3I3NO7S- — CID 171407098
(2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-2-carboximidate (PubChem CID 171407098) has the molecular formula C17H10F3I3NO7S- and a molecular weight of 810.04 g/mol. Its IUPAC name is (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-2-carboximidate.
| Compound Name | (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-2-carboximidate |
|---|---|
| PubChem CID | 171407098 |
| Molecular Formula | C17H10F3I3NO7S- |
| Molecular Weight | 810.04 g/mol |
| Exact Mass | 809.73 |
| IUPAC Name | (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-2-carboximidate |
| SMILES | O=C(OC1C2CC3C(OC(=O)C31)C2/C([O-])=N/S(=O)(=O)C(F)(F)F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C17H11F3I3NO7S/c18-17(19,20)32(28,29)24-14(25)9-5-3-6-10(16(27)31-12(6)9)13(5)30-15(26)7-1-4(21)2-8(22)11(7)23/h1-2,5-6,9-10,12-13H,3H2,(H,24,25)/p-1 |
| InChIKey | KNFZZRFLSIGQNJ-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|