C20H14F3IN6O — CID 171409333
1-[(1S)-1-[3-(5-cyano-2-pyridinyl)pyrazin-2-yl]ethyl]-3-[2-iodo-4-(trifluoromethyl)phenyl]urea (PubChem CID 171409333) has the molecular formula C20H14F3IN6O and a molecular weight of 538.27 g/mol. Its IUPAC name is 1-[(1S)-1-[3-(5-cyano-2-pyridinyl)pyrazin-2-yl]ethyl]-3-[2-iodo-4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S)-1-[3-(5-cyano-2-pyridinyl)pyrazin-2-yl]ethyl]-3-[2-iodo-4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 171409333 |
| Molecular Formula | C20H14F3IN6O |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 1-[(1S)-1-[3-(5-cyano-2-pyridinyl)pyrazin-2-yl]ethyl]-3-[2-iodo-4-(trifluoromethyl)phenyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(C(F)(F)F)cc1I)c1nccnc1-c1ccc(C#N)cn1 |
| InChI | InChI=1S/C20H14F3IN6O/c1-11(17-18(27-7-6-26-17)16-4-2-12(9-25)10-28-16)29-19(31)30-15-5-3-13(8-14(15)24)20(21,22)23/h2-8,10-11H,1H3,(H2,29,30,31)/t11-/m0/s1 |
| InChIKey | GPDJUYRTNYFKDA-NSHDSACASA-N |
| XLogP | 4.92 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|