C23H16Cl2N8O3 — CID 171409350
1-[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 171409350) has the molecular formula C23H16Cl2N8O3 and a molecular weight of 523.34 g/mol. Its IUPAC name is 1-[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 171409350 |
| Molecular Formula | C23H16Cl2N8O3 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 1-[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]-3-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cc(N2C(=O)c3ccccc3C2=O)c(Cl)cc1Cl)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C23H16Cl2N8O3/c1-12(19-28-11-29-33(19)22-26-7-4-8-27-22)30-23(36)31-17-10-18(16(25)9-15(17)24)32-20(34)13-5-2-3-6-14(13)21(32)35/h2-12H,1H3,(H2,30,31,36)/t12-/m0/s1 |
| InChIKey | STGAQDRQILNSSD-LBPRGKRZSA-N |
| XLogP | 4.05 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|