C21H17N3O4 — CID 171418299
1,2-dioxo-5-(3-propan-2-ylanilino)-3H-pyrrolo[2,3-c]isoquinoline-7-carboxylic acid (PubChem CID 171418299) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 1,2-dioxo-5-(3-propan-2-ylanilino)-3H-pyrrolo[2,3-c]isoquinoline-7-carboxylic acid.
| Compound Name | 1,2-dioxo-5-(3-propan-2-ylanilino)-3H-pyrrolo[2,3-c]isoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 171418299 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1,2-dioxo-5-(3-propan-2-ylanilino)-3H-pyrrolo[2,3-c]isoquinoline-7-carboxylic acid |
| SMILES | CC(C)c1cccc(Nc2nc3c(c4ccc(C(=O)O)cc24)C(=O)C(=O)N3)c1 |
| InChI | InChI=1S/C21H17N3O4/c1-10(2)11-4-3-5-13(8-11)22-18-15-9-12(21(27)28)6-7-14(15)16-17(25)20(26)24-19(16)23-18/h3-10H,1-2H3,(H,27,28)(H2,22,23,24,25,26) |
| InChIKey | JWIATLNBSWFZOZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|