C16H14NO4S2- — CID 171422362
benzenesulfonyl-[2,4-bis(ethenyl)phenyl]sulfonylazanide (PubChem CID 171422362) has the molecular formula C16H14NO4S2- and a molecular weight of 348.43 g/mol. Its IUPAC name is benzenesulfonyl-[2,4-bis(ethenyl)phenyl]sulfonylazanide.
| Compound Name | benzenesulfonyl-[2,4-bis(ethenyl)phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 171422362 |
| Molecular Formula | C16H14NO4S2- |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | benzenesulfonyl-[2,4-bis(ethenyl)phenyl]sulfonylazanide |
| SMILES | C=Cc1ccc(S(=O)(=O)[N-]S(=O)(=O)c2ccccc2)c(C=C)c1 |
| InChI | InChI=1S/C16H14NO4S2/c1-3-13-10-11-16(14(4-2)12-13)23(20,21)17-22(18,19)15-8-6-5-7-9-15/h3-12H,1-2H2/q-1 |
| InChIKey | ZVJRPFRMMDRMIL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |