About ethenyl 2-ethenylbenzenesulfonate;styrene
ethenyl 2-ethenylbenzenesulfonate;styrene (PubChem CID 174365120) has the molecular formula C18H18O3S
and a molecular weight of 314.41 g/mol. Its IUPAC name is ethenyl 2-ethenylbenzenesulfonate;styrene.
Molecular Properties
| Compound Name | ethenyl 2-ethenylbenzenesulfonate;styrene |
| PubChem CID | 174365120 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | ethenyl 2-ethenylbenzenesulfonate;styrene |
| SMILES | C=COS(=O)(=O)c1ccccc1C=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H10O3S.C8H8/c1-3-9-7-5-6-8-10(9)14(11,12)13-4-2;1-2-8-6-4-3-5-7-8/h3-8H,1-2H2;2-7H,1H2 |
| InChIKey | XHKZIRAKEPKGMG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-ethenylbenzenesulfonate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-ethenylbenzenesulfonate;styrene?
The IUPAC name of ethenyl 2-ethenylbenzenesulfonate;styrene (CID 174365120) is ethenyl 2-ethenylbenzenesulfonate;styrene.
What is the SMILES notation for ethenyl 2-ethenylbenzenesulfonate;styrene?
The canonical SMILES for ethenyl 2-ethenylbenzenesulfonate;styrene is C=COS(=O)(=O)c1ccccc1C=C.C=Cc1ccccc1.
What is the InChIKey of ethenyl 2-ethenylbenzenesulfonate;styrene?
The InChIKey is XHKZIRAKEPKGMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S.C8H8/c1-3-9-7-5-6-8-10(9)14(11,12)13-4-2;1-2-8-6-4-3-5-7-8/h3-8H,1-2H2;2-7H,1H2.
What are the key properties of ethenyl 2-ethenylbenzenesulfonate;styrene?
ethenyl 2-ethenylbenzenesulfonate;styrene has a molecular weight of 314.41 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-ethenylbenzenesulfonate;styrene is sourced from PubChem (CID 174365120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).