C12H5F5NO4S2- — CID 144769244
benzenesulfonyl-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide (PubChem CID 144769244) has the molecular formula C12H5F5NO4S2- and a molecular weight of 386.30 g/mol. Its IUPAC name is benzenesulfonyl-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide.
| Compound Name | benzenesulfonyl-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide |
|---|---|
| PubChem CID | 144769244 |
| Molecular Formula | C12H5F5NO4S2- |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | benzenesulfonyl-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C12H5F5NO4S2/c13-7-8(14)10(16)12(11(17)9(7)15)24(21,22)18-23(19,20)6-4-2-1-3-5-6/h1-5H/q-1 |
| InChIKey | MJJRVSVVBPMRSL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|