C10H8F3N3O3 — CID 171436775
3-nitro-5-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,2-c]pyridin-4-one (PubChem CID 171436775) has the molecular formula C10H8F3N3O3 and a molecular weight of 275.19 g/mol. Its IUPAC name is 3-nitro-5-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-nitro-5-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 171436775 |
| Molecular Formula | C10H8F3N3O3 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-nitro-5-(1,1,1-trifluoropropan-2-yl)-1H-pyrrolo[3,2-c]pyridin-4-one |
| SMILES | CC(n1ccc2[nH]cc([N+](=O)[O-])c2c1=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O3/c1-5(10(11,12)13)15-3-2-6-8(9(15)17)7(4-14-6)16(18)19/h2-5,14H,1H3 |
| InChIKey | NLXSOYFADIDTHD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|