C75H62IrN3O — CID 171438435
CID 171438435 (PubChem CID 171438435) has the molecular formula C75H62IrN3O and a molecular weight of 1213.56 g/mol.
| Compound Name | CID 171438435 |
|---|---|
| PubChem CID | 171438435 |
| Molecular Formula | C75H62IrN3O |
| Molecular Weight | 1213.56 g/mol |
| Exact Mass | 1213.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1C1C=CN=C1c1[c-]ccc2c1oc1cc3c(ccc4ccccc43)cc12.[Ir+3].[c-]1ccccc1-c1cc(CCc2ccccc2Cc2ccccc2CCc2cc[c-]c(-c3ccccn3)c2)ccn1 |
| InChI | InChI=1S/C39H32N2.C36H30NO.Ir/c1-2-14-34(15-3-1)39-28-31(24-26-41-39)21-23-33-13-5-7-17-36(33)29-35-16-6-4-12-32(35)22-20-30-11-10-18-37(27-30)38-19-8-9-25-40-38;1-21(2)25-11-7-12-26(22(3)4)34(25)29-17-18-37-35(29)30-14-8-13-28-32-19-24-16-15-23-9-5-6-10-27(23)31(24)20-33(32)38-36(28)30;/h1-14,16-17,19,24-28H,20-23,29H2;5-13,15-22,29H,1-4H3;/q-2;-1;+3 |
| InChIKey | QGVKUCIYCYTXSY-UHFFFAOYSA-N |
| XLogP | 18.61 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.56 |
| LogP ≤ 5 | 18.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|