C11H13ClN4O — CID 171441448
(4S)-3-[(2-chloro-5-methylpyrimidin-4-yl)amino]oxane-4-carbonitrile (PubChem CID 171441448) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is (4S)-3-[(2-chloro-5-methylpyrimidin-4-yl)amino]oxane-4-carbonitrile.
| Compound Name | (4S)-3-[(2-chloro-5-methylpyrimidin-4-yl)amino]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 171441448 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (4S)-3-[(2-chloro-5-methylpyrimidin-4-yl)amino]oxane-4-carbonitrile |
| SMILES | Cc1cnc(Cl)nc1NC1COCC[C@@H]1C#N |
| InChI | InChI=1S/C11H13ClN4O/c1-7-5-14-11(12)16-10(7)15-9-6-17-3-2-8(9)4-13/h5,8-9H,2-3,6H2,1H3,(H,14,15,16)/t8-,9?/m1/s1 |
| InChIKey | QATWKFXYAPMGMO-VEDVMXKPSA-N |
| XLogP | 1.78 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |