C49H33N — CID 171452642
1,1',2,2',3,3',4',5,5',6,6',7,7',8,8'-pentadecadeuterio-N,N-bis(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine (PubChem CID 171452642) has the molecular formula C49H33N and a molecular weight of 650.90 g/mol. Its IUPAC name is 1,1',2,2',3,3',4',5,5',6,6',7,7',8,8'-pentadecadeuterio-N,N-bis(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | 1,1',2,2',3,3',4',5,5',6,6',7,7',8,8'-pentadecadeuterio-N,N-bis(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 171452642 |
| Molecular Formula | C49H33N |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 1,1',2,2',3,3',4',5,5',6,6',7,7',8,8'-pentadecadeuterio-N,N-bis(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c([2H])c([2H])c1C21c2c([2H])c([2H])c([2H])c([2H])c2-c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)c([2H])c([2H])c([2H])c21 |
| InChI | InChI=1S/C49H33N/c1-3-14-34(15-4-1)36-26-30-38(31-27-36)50(39-32-28-37(29-33-39)35-16-5-2-6-17-35)47-25-13-24-46-48(47)42-20-9-12-23-45(42)49(46)43-21-10-7-18-40(43)41-19-8-11-22-44(41)49/h1-33H/i7D,8D,9D,10D,11D,12D,13D,18D,19D,20D,21D,22D,23D,24D,25D |
| InChIKey | MJNGJYRNDATJHR-YAYSYVAZSA-N |
| XLogP | 12.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |