C47H37N — CID 171461549
1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-9-methyl-9-phenyl-N-(4-phenylphenyl)fluoren-4-amine (PubChem CID 171461549) has the molecular formula C47H37N and a molecular weight of 622.86 g/mol. Its IUPAC name is 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-9-methyl-9-phenyl-N-(4-phenylphenyl)fluoren-4-amine.
| Compound Name | 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-9-methyl-9-phenyl-N-(4-phenylphenyl)fluoren-4-amine |
|---|---|
| PubChem CID | 171461549 |
| Molecular Formula | C47H37N |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | 1,2,3,5,6,7,8-heptadeuterio-N-(9,9-dimethylfluoren-2-yl)-9-methyl-9-phenyl-N-(4-phenylphenyl)fluoren-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c([2H])c([2H])c([2H])c1C2(C)c1ccccc1 |
| InChI | InChI=1S/C47H37N/c1-46(2)40-21-12-10-19-37(40)38-30-29-36(31-43(38)46)48(35-27-25-33(26-28-35)32-15-6-4-7-16-32)44-24-14-23-42-45(44)39-20-11-13-22-41(39)47(42,3)34-17-8-5-9-18-34/h4-31H,1-3H3/i11D,13D,14D,20D,22D,23D,24D |
| InChIKey | GGLUOWNBJZQUBZ-VSULQJLVSA-N |
| XLogP | 12.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |