C57H41N — CID 171453277
1,3,4,5,6,7,8-heptadeuterio-N-(9-methyl-9-phenylfluoren-2-yl)-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N-(2-phenylphenyl)fluoren-2-amine (PubChem CID 171453277) has the molecular formula C57H41N and a molecular weight of 757.07 g/mol. Its IUPAC name is 1,3,4,5,6,7,8-heptadeuterio-N-(9-methyl-9-phenylfluoren-2-yl)-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N-(2-phenylphenyl)fluoren-2-amine.
| Compound Name | 1,3,4,5,6,7,8-heptadeuterio-N-(9-methyl-9-phenylfluoren-2-yl)-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N-(2-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171453277 |
| Molecular Formula | C57H41N |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | 1,3,4,5,6,7,8-heptadeuterio-N-(9-methyl-9-phenylfluoren-2-yl)-9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N-(2-phenylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3c([2H])c([2H])c([2H])c([2H])c3-c3c([2H])c([2H])c(N(c4ccc5c(c4)C(C)(c4ccccc4)c4ccccc4-5)c4ccccc4-c4ccccc4)c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C57H41N/c1-56(41-22-8-3-9-23-41)51-31-17-14-29-47(51)49-36-34-44(38-53(49)56)58(55-33-19-16-28-46(55)40-20-6-2-7-21-40)45-35-37-50-48-30-15-18-32-52(48)57(54(50)39-45,42-24-10-4-11-25-42)43-26-12-5-13-27-43/h2-39H,1H3/i4D,5D,10D,11D,12D,13D,15D,18D,24D,25D,26D,27D,30D,32D,35D,37D,39D |
| InChIKey | ZTQIPGCDOPSKNV-QUOXNSHGSA-N |
| XLogP | 14.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |