C21H24F3N3O4S — CID 171453764
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 171453764) has the molecular formula C21H24F3N3O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 171453764 |
| Molecular Formula | C21H24F3N3O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | C[C@]1(n2nc(-c3cccc(OCC(F)(F)F)c3)c3c2CC(C(N)=O)CC3)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24F3N3O4S/c1-20(7-8-32(29,30)12-20)27-17-10-14(19(25)28)5-6-16(17)18(26-27)13-3-2-4-15(9-13)31-11-21(22,23)24/h2-4,9,14H,5-8,10-12H2,1H3,(H2,25,28)/t14?,20-/m0/s1 |
| InChIKey | ZPCRFSFAUNPGQL-LGTGAQBVSA-N |
| XLogP | 2.62 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |