C25H27F3N4O4S — CID 174236828
3-[3-(difluoromethoxy)phenyl]-N-(1,1-dihydroxy-3-methylthiolan-3-yl)-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 174236828) has the molecular formula C25H27F3N4O4S and a molecular weight of 536.58 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)phenyl]-N-(1,1-dihydroxy-3-methylthiolan-3-yl)-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 3-[3-(difluoromethoxy)phenyl]-N-(1,1-dihydroxy-3-methylthiolan-3-yl)-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 174236828 |
| Molecular Formula | C25H27F3N4O4S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 3-[3-(difluoromethoxy)phenyl]-N-(1,1-dihydroxy-3-methylthiolan-3-yl)-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC1(NC(=O)C2CCc3c(-c4cccc(OC(F)F)c4)nn(-c4ccc(F)cn4)c3C2)CCS(O)(O)C1 |
| InChI | InChI=1S/C25H27F3N4O4S/c1-25(9-10-37(34,35)14-25)30-23(33)16-5-7-19-20(12-16)32(21-8-6-17(26)13-29-21)31-22(19)15-3-2-4-18(11-15)36-24(27)28/h2-4,6,8,11,13,16,24,34-35H,5,7,9-10,12,14H2,1H3,(H,30,33) |
| InChIKey | ZMOKENOOSHASNA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |