C23H27F2N3O2S — CID 175471849
3-[3-(difluoromethoxy)phenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 175471849) has the molecular formula C23H27F2N3O2S and a molecular weight of 447.55 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)phenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 3-[3-(difluoromethoxy)phenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 175471849 |
| Molecular Formula | C23H27F2N3O2S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-[3-(difluoromethoxy)phenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C)n1nc(-c2cccc(OC(F)F)c2)c2c1CC(C(=O)NC1(C)CC(=S)C1)CC2 |
| InChI | InChI=1S/C23H27F2N3O2S/c1-13(2)28-19-10-15(21(29)26-23(3)11-17(31)12-23)7-8-18(19)20(27-28)14-5-4-6-16(9-14)30-22(24)25/h4-6,9,13,15,22H,7-8,10-12H2,1-3H3,(H,26,29) |
| InChIKey | HIDLVTAMCPKPNR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|