C23H26F3N3O2S — CID 175471891
3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 175471891) has the molecular formula C23H26F3N3O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 175471891 |
| Molecular Formula | C23H26F3N3O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-propan-2-yl-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C)n1nc(-c2cc(OC(F)F)ccc2F)c2c1CC(C(=O)NC1(C)CC(=S)C1)CC2 |
| InChI | InChI=1S/C23H26F3N3O2S/c1-12(2)29-19-8-13(21(30)27-23(3)10-15(32)11-23)4-6-16(19)20(28-29)17-9-14(31-22(25)26)5-7-18(17)24/h5,7,9,12-13,22H,4,6,8,10-11H2,1-3H3,(H,27,30) |
| InChIKey | XQXPEFXOUAFIPS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|