C21H22F3N3O4S2 — CID 175471928
3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-methylsulfonyl-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 175471928) has the molecular formula C21H22F3N3O4S2 and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-methylsulfonyl-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-methylsulfonyl-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 175471928 |
| Molecular Formula | C21H22F3N3O4S2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-1-methylsulfonyl-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC1(NC(=O)C2CCc3c(-c4cc(OC(F)F)ccc4F)nn(S(C)(=O)=O)c3C2)CC(=S)C1 |
| InChI | InChI=1S/C21H22F3N3O4S2/c1-21(9-13(32)10-21)25-19(28)11-3-5-14-17(7-11)27(33(2,29)30)26-18(14)15-8-12(31-20(23)24)4-6-16(15)22/h4,6,8,11,20H,3,5,7,9-10H2,1-2H3,(H,25,28) |
| InChIKey | GIMHMNKGIHKGTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|