C24H30F3N3O4S — CID 174236838
1-[(1R)-1-cyclopropylethyl]-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 174236838) has the molecular formula C24H30F3N3O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is 1-[(1R)-1-cyclopropylethyl]-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 1-[(1R)-1-cyclopropylethyl]-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 174236838 |
| Molecular Formula | C24H30F3N3O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 1-[(1R)-1-cyclopropylethyl]-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | C[C@H](C1CC1)n1nc(-c2cc(OC(F)F)ccc2F)c2c1CC(C(=O)NC1(C)CS(O)(O)C1)CC2 |
| InChI | InChI=1S/C24H30F3N3O4S/c1-13(14-3-4-14)30-20-9-15(22(31)28-24(2)11-35(32,33)12-24)5-7-17(20)21(29-30)18-10-16(34-23(26)27)6-8-19(18)25/h6,8,10,13-15,23,32-33H,3-5,7,9,11-12H2,1-2H3,(H,28,31)/t13-,15?/m1/s1 |
| InChIKey | OTLVTTWBFIPGOI-AFYYWNPRSA-N |
| XLogP | 5.01 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |