C24H25F3N4O4S2 — CID 169222636
(6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-[1-(1,3-thiazol-2-yl)ethyl]-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 169222636) has the molecular formula C24H25F3N4O4S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-[1-(1,3-thiazol-2-yl)ethyl]-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-[1-(1,3-thiazol-2-yl)ethyl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 169222636 |
| Molecular Formula | C24H25F3N4O4S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(3-methyl-1,1-dioxothietan-3-yl)-1-[1-(1,3-thiazol-2-yl)ethyl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(c1nccs1)n1nc(-c2cc(OC(F)F)ccc2F)c2c1C[C@H](C(=O)NC1(C)CS(=O)(=O)C1)CC2 |
| InChI | InChI=1S/C24H25F3N4O4S2/c1-13(22-28-7-8-36-22)31-19-9-14(21(32)29-24(2)11-37(33,34)12-24)3-5-16(19)20(30-31)17-10-15(35-23(26)27)4-6-18(17)25/h4,6-8,10,13-14,23H,3,5,9,11-12H2,1-2H3,(H,29,32)/t13?,14-/m1/s1 |
| InChIKey | WPUUGRPOOPFEMZ-ARLHGKGLSA-N |
| XLogP | 3.76 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |