C24H21F5N4O4S — CID 164550905
(6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(3,5-difluoro-2-pyridinyl)-N-(3-methyl-1,1-dioxothietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 164550905) has the molecular formula C24H21F5N4O4S and a molecular weight of 556.51 g/mol. Its IUPAC name is (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(3,5-difluoro-2-pyridinyl)-N-(3-methyl-1,1-dioxothietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(3,5-difluoro-2-pyridinyl)-N-(3-methyl-1,1-dioxothietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 164550905 |
| Molecular Formula | C24H21F5N4O4S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | (6R)-3-[5-(difluoromethoxy)-2-fluorophenyl]-1-(3,5-difluoro-2-pyridinyl)-N-(3-methyl-1,1-dioxothietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC1(NC(=O)[C@@H]2CCc3c(-c4cc(OC(F)F)ccc4F)nn(-c4ncc(F)cc4F)c3C2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C24H21F5N4O4S/c1-24(10-38(35,36)11-24)31-22(34)12-2-4-15-19(6-12)33(21-18(27)7-13(25)9-30-21)32-20(15)16-8-14(37-23(28)29)3-5-17(16)26/h3,5,7-9,12,23H,2,4,6,10-11H2,1H3,(H,31,34)/t12-/m1/s1 |
| InChIKey | HAIANXCAVSPIAG-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |