C23H23F3N4O2S — CID 175471913
(6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 175471913) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 175471913 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1-methyl-3-sulfanylidenecyclobutyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C#N)n1nc(-c2cc(OC(F)F)ccc2F)c2c1C[C@H](C(=O)NC1(C)CC(=S)C1)CC2 |
| InChI | InChI=1S/C23H23F3N4O2S/c1-12(11-27)30-19-7-13(21(31)28-23(2)9-15(33)10-23)3-5-16(19)20(29-30)17-8-14(32-22(25)26)4-6-18(17)24/h4,6,8,12-13,22H,3,5,7,9-10H2,1-2H3,(H,28,31)/t12?,13-/m1/s1 |
| InChIKey | PDLUSMBKIAYGJX-ZGTCLIOFSA-N |
| XLogP | 4.52 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|