C22H25F3N4O4S — CID 174236657
(6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 174236657) has the molecular formula C22H25F3N4O4S and a molecular weight of 498.53 g/mol. Its IUPAC name is (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 174236657 |
| Molecular Formula | C22H25F3N4O4S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (6R)-1-(1-cyanoethyl)-3-[5-(difluoromethoxy)-2-fluorophenyl]-N-(1,1-dihydroxy-3-methylthietan-3-yl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | CC(C#N)n1nc(-c2cc(OC(F)F)ccc2F)c2c1C[C@H](C(=O)NC1(C)CS(O)(O)C1)CC2 |
| InChI | InChI=1S/C22H25F3N4O4S/c1-12(9-26)29-18-7-13(20(30)27-22(2)10-34(31,32)11-22)3-5-15(18)19(28-29)16-8-14(33-21(24)25)4-6-17(16)23/h4,6,8,12-13,21,31-32H,3,5,7,10-11H2,1-2H3,(H,27,30)/t12?,13-/m1/s1 |
| InChIKey | CIIGFISPAJUHQT-ZGTCLIOFSA-N |
| XLogP | 4.12 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |