C21H29NO3S — CID 171454510
6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylbutanoate (PubChem CID 171454510) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylbutanoate.
| Compound Name | 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 171454510 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCSc1cc(=O)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H29NO3S/c1-4-16(2)21(24)25-13-9-5-6-10-14-26-19-15-20(23)22(3)18-12-8-7-11-17(18)19/h7-8,11-12,15-16H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | TXBZYSHXIAWYAT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|