C8H15N2- — CID 171466717
5-methanidyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine (PubChem CID 171466717) has the molecular formula C8H15N2- and a molecular weight of 139.22 g/mol. Its IUPAC name is 5-methanidyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine.
| Compound Name | 5-methanidyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 171466717 |
| Molecular Formula | C8H15N2- |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 5-methanidyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
| SMILES | [CH2-]N1CCC2NCCC2C1 |
| InChI | InChI=1S/C8H15N2/c1-10-5-3-8-7(6-10)2-4-9-8/h7-9H,1-6H2/q-1 |
| InChIKey | HNTJJRSAFDKCKZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|