C6H13N2P — CID 59339920
[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]phosphane (PubChem CID 59339920) has the molecular formula C6H13N2P and a molecular weight of 144.16 g/mol. Its IUPAC name is [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]phosphane.
| Compound Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]phosphane |
|---|---|
| PubChem CID | 59339920 |
| Molecular Formula | C6H13N2P |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]phosphane |
| SMILES | PN1C[C@H]2CCN[C@H]2C1 |
| InChI | InChI=1S/C6H13N2P/c9-8-3-5-1-2-7-6(5)4-8/h5-7H,1-4,9H2/t5-,6+/m1/s1 |
| InChIKey | BEXGIVNSNJPRLX-RITPCOANSA-N |
| XLogP | 0.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|