C40H39NO2Si — CID 171468525
trimethyl-[6-[7-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,3-benzoxazol-2-yl]dibenzofuran-3-yl]silane (PubChem CID 171468525) has the molecular formula C40H39NO2Si and a molecular weight of 593.84 g/mol. Its IUPAC name is trimethyl-[6-[7-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,3-benzoxazol-2-yl]dibenzofuran-3-yl]silane.
| Compound Name | trimethyl-[6-[7-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,3-benzoxazol-2-yl]dibenzofuran-3-yl]silane |
|---|---|
| PubChem CID | 171468525 |
| Molecular Formula | C40H39NO2Si |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | trimethyl-[6-[7-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,3-benzoxazol-2-yl]dibenzofuran-3-yl]silane |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-c1cccc2nc(-c3cccc4c3oc3cc([Si](C)(C)C)ccc34)oc12 |
| InChI | InChI=1S/C40H39NO2Si/c1-24(2)33-21-27(26-13-9-8-10-14-26)22-34(25(3)4)37(33)31-16-12-18-35-39(31)43-40(41-35)32-17-11-15-30-29-20-19-28(44(5,6)7)23-36(29)42-38(30)32/h8-25H,1-7H3 |
| InChIKey | QKEDERDZKZSKBZ-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|