C30H27N3O3 — CID 171473025
4,5,6-tris[(4-ethenylphenyl)methoxy]triazine (PubChem CID 171473025) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4,5,6-tris[(4-ethenylphenyl)methoxy]triazine.
| Compound Name | 4,5,6-tris[(4-ethenylphenyl)methoxy]triazine |
|---|---|
| PubChem CID | 171473025 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4,5,6-tris[(4-ethenylphenyl)methoxy]triazine |
| SMILES | C=Cc1ccc(COc2nnnc(OCc3ccc(C=C)cc3)c2OCc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C30H27N3O3/c1-4-22-7-13-25(14-8-22)19-34-28-29(35-20-26-15-9-23(5-2)10-16-26)31-33-32-30(28)36-21-27-17-11-24(6-3)12-18-27/h4-18H,1-3,19-21H2 |
| InChIKey | PEAOWUSHXCMRIR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |