C15H10F4O2 — CID 140941316
4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorophenol (PubChem CID 140941316) has the molecular formula C15H10F4O2 and a molecular weight of 298.24 g/mol. Its IUPAC name is 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorophenol.
| Compound Name | 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorophenol |
|---|---|
| PubChem CID | 140941316 |
| Molecular Formula | C15H10F4O2 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorophenol |
| SMILES | C=Cc1ccc(COc2c(F)c(F)c(O)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F4O2/c1-2-8-3-5-9(6-4-8)7-21-15-12(18)10(16)14(20)11(17)13(15)19/h2-6,20H,1,7H2 |
| InChIKey | KLYKDVHAYLIYBD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|