C37H36O5 — CID 135364367
2-hydroxy-2-methyl-1-[2,3,4-tris[(4-ethenylphenyl)methoxy]phenyl]propan-1-one (PubChem CID 135364367) has the molecular formula C37H36O5 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-[2,3,4-tris[(4-ethenylphenyl)methoxy]phenyl]propan-1-one.
| Compound Name | 2-hydroxy-2-methyl-1-[2,3,4-tris[(4-ethenylphenyl)methoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 135364367 |
| Molecular Formula | C37H36O5 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2-hydroxy-2-methyl-1-[2,3,4-tris[(4-ethenylphenyl)methoxy]phenyl]propan-1-one |
| SMILES | C=Cc1ccc(COc2ccc(C(=O)C(C)(C)O)c(OCc3ccc(C=C)cc3)c2OCc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C37H36O5/c1-6-26-9-15-29(16-10-26)23-40-33-22-21-32(36(38)37(4,5)39)34(41-24-30-17-11-27(7-2)12-18-30)35(33)42-25-31-19-13-28(8-3)14-20-31/h6-22,39H,1-3,23-25H2,4-5H3 |
| InChIKey | LARHMJSGWJEESB-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |