C22H23Cl2N3O3 — CID 171477492
5-chloro-3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid (PubChem CID 171477492) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is 5-chloro-3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171477492 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 5-chloro-3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1N1CCN(C(O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-13-17(24)3-2-4-19(13)26-7-9-27(10-8-26)20(28)12-16-15-11-14(23)5-6-18(15)25-21(16)22(29)30/h2-6,11,20,25,28H,7-10,12H2,1H3,(H,29,30) |
| InChIKey | VYJZTDMGOCEWOU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|