C23H26ClN3O3 — CID 171477480
5-chloro-3-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid (PubChem CID 171477480) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 5-chloro-3-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171477480 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 5-chloro-3-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-2-hydroxyethyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(N2CCN(C(O)Cc3c(C(=O)O)[nH]c4ccc(Cl)cc34)CC2)c(C)c1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-14-3-6-20(15(2)11-14)26-7-9-27(10-8-26)21(28)13-18-17-12-16(24)4-5-19(17)25-22(18)23(29)30/h3-6,11-12,21,25,28H,7-10,13H2,1-2H3,(H,29,30) |
| InChIKey | PXTDDAZGNXRLLR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|