C27H30N8O2 — CID 171481663
1-[3-cyano-7-ethoxy-4-(1H-indazol-5-ylamino)quinolin-6-yl]-3-(1-ethylpiperidin-4-yl)urea (PubChem CID 171481663) has the molecular formula C27H30N8O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 1-[3-cyano-7-ethoxy-4-(1H-indazol-5-ylamino)quinolin-6-yl]-3-(1-ethylpiperidin-4-yl)urea.
| Compound Name | 1-[3-cyano-7-ethoxy-4-(1H-indazol-5-ylamino)quinolin-6-yl]-3-(1-ethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 171481663 |
| Molecular Formula | C27H30N8O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 1-[3-cyano-7-ethoxy-4-(1H-indazol-5-ylamino)quinolin-6-yl]-3-(1-ethylpiperidin-4-yl)urea |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc4[nH]ncc4c3)c2cc1NC(=O)NC1CCN(CC)CC1 |
| InChI | InChI=1S/C27H30N8O2/c1-3-35-9-7-19(8-10-35)32-27(36)33-24-12-21-23(13-25(24)37-4-2)29-15-18(14-28)26(21)31-20-5-6-22-17(11-20)16-30-34-22/h5-6,11-13,15-16,19H,3-4,7-10H2,1-2H3,(H,29,31)(H,30,34)(H2,32,33,36) |
| InChIKey | IZRPDUHRSHFEAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |