C26H33ClFN3O3 — CID 171481717
tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(dimethylcarbamoyl)piperidin-3-yl]carbamate (PubChem CID 171481717) has the molecular formula C26H33ClFN3O3 and a molecular weight of 490.02 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(dimethylcarbamoyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(dimethylcarbamoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171481717 |
| Molecular Formula | C26H33ClFN3O3 |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(dimethylcarbamoyl)piperidin-3-yl]carbamate |
| SMILES | CN(C)C(=O)C1(NC(=O)OC(C)(C)C)CCCN(c2ccc(-c3cccc(F)c3)cc2CCl)C1 |
| InChI | InChI=1S/C26H33ClFN3O3/c1-25(2,3)34-24(33)29-26(23(32)30(4)5)12-7-13-31(17-26)22-11-10-19(14-20(22)16-27)18-8-6-9-21(28)15-18/h6,8-11,14-15H,7,12-13,16-17H2,1-5H3,(H,29,33) |
| InChIKey | SUDXRDCATMPNBR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|