C25H31ClFN3O3 — CID 171481721
tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(methylcarbamoyl)piperidin-3-yl]carbamate (PubChem CID 171481721) has the molecular formula C25H31ClFN3O3 and a molecular weight of 475.99 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(methylcarbamoyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(methylcarbamoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171481721 |
| Molecular Formula | C25H31ClFN3O3 |
| Molecular Weight | 475.99 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | tert-butyl N-[1-[2-(chloromethyl)-4-(3-fluorophenyl)phenyl]-3-(methylcarbamoyl)piperidin-3-yl]carbamate |
| SMILES | CNC(=O)C1(NC(=O)OC(C)(C)C)CCCN(c2ccc(-c3cccc(F)c3)cc2CCl)C1 |
| InChI | InChI=1S/C25H31ClFN3O3/c1-24(2,3)33-23(32)29-25(22(31)28-4)11-6-12-30(16-25)21-10-9-18(13-19(21)15-26)17-7-5-8-20(27)14-17/h5,7-10,13-14H,6,11-12,15-16H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | UTYZWLUQUFQGHD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|