C27H24Cl2N2O4 — CID 171481936
(2S)-2-amino-3-[4-[[5-amino-2-(naphthalen-2-ylmethoxy)phenyl]methoxy]-3,5-dichlorophenyl]propanoic acid (PubChem CID 171481936) has the molecular formula C27H24Cl2N2O4 and a molecular weight of 511.41 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[5-amino-2-(naphthalen-2-ylmethoxy)phenyl]methoxy]-3,5-dichlorophenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[5-amino-2-(naphthalen-2-ylmethoxy)phenyl]methoxy]-3,5-dichlorophenyl]propanoic acid |
|---|---|
| PubChem CID | 171481936 |
| Molecular Formula | C27H24Cl2N2O4 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (2S)-2-amino-3-[4-[[5-amino-2-(naphthalen-2-ylmethoxy)phenyl]methoxy]-3,5-dichlorophenyl]propanoic acid |
| SMILES | Nc1ccc(OCc2ccc3ccccc3c2)c(COc2c(Cl)cc(C[C@H](N)C(=O)O)cc2Cl)c1 |
| InChI | InChI=1S/C27H24Cl2N2O4/c28-22-10-17(12-24(31)27(32)33)11-23(29)26(22)35-15-20-13-21(30)7-8-25(20)34-14-16-5-6-18-3-1-2-4-19(18)9-16/h1-11,13,24H,12,14-15,30-31H2,(H,32,33)/t24-/m0/s1 |
| InChIKey | WRFOIQQQRVBYGY-DEOSSOPVSA-N |
| XLogP | 5.84 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|