C7H5ClN2O — CID 171482939
4-chloro-1H-pyrrolo[3,2-c]pyridin-7-ol (PubChem CID 171482939) has the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. Its IUPAC name is 4-chloro-1H-pyrrolo[3,2-c]pyridin-7-ol.
| Compound Name | 4-chloro-1H-pyrrolo[3,2-c]pyridin-7-ol |
|---|---|
| PubChem CID | 171482939 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 4-chloro-1H-pyrrolo[3,2-c]pyridin-7-ol |
| SMILES | Oc1cnc(Cl)c2cc[nH]c12 |
| InChI | InChI=1S/C7H5ClN2O/c8-7-4-1-2-9-6(4)5(11)3-10-7/h1-3,9,11H |
| InChIKey | SONVAIUWTPLMFT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|