About cyclopropylazanide;palladium(2+)
cyclopropylazanide;palladium(2+) (PubChem CID 171483423) has the molecular formula C6H12N2Pd
and a molecular weight of 218.60 g/mol. Its IUPAC name is cyclopropylazanide;palladium(2+).
Molecular Properties
| Compound Name | cyclopropylazanide;palladium(2+) |
| PubChem CID | 171483423 |
| Molecular Formula | C6H12N2Pd |
| Molecular Weight | 218.60 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | cyclopropylazanide;palladium(2+) |
| SMILES | [NH-]C1CC1.[NH-]C1CC1.[Pd+2] |
| InChI | InChI=1S/2C3H6N.Pd/c2*4-3-1-2-3;/h2*3-4H,1-2H2;/q2*-1;+2 |
| InChIKey | LOJJHDDHOQHDPF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropylazanide;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylazanide;palladium(2+)?
The IUPAC name of cyclopropylazanide;palladium(2+) (CID 171483423) is cyclopropylazanide;palladium(2+).
What is the SMILES notation for cyclopropylazanide;palladium(2+)?
The canonical SMILES for cyclopropylazanide;palladium(2+) is [NH-]C1CC1.[NH-]C1CC1.[Pd+2].
What is the InChIKey of cyclopropylazanide;palladium(2+)?
The InChIKey is LOJJHDDHOQHDPF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6N.Pd/c2*4-3-1-2-3;/h2*3-4H,1-2H2;/q2*-1;+2.
What are the key properties of cyclopropylazanide;palladium(2+)?
cyclopropylazanide;palladium(2+) has a molecular weight of 218.60 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylazanide;palladium(2+) is sourced from PubChem (CID 171483423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).