About (3-propan-2-ylcyclopentyl)azanide;tungsten
(3-propan-2-ylcyclopentyl)azanide;tungsten (PubChem CID 153472180) has the molecular formula C8H16NW-
and a molecular weight of 310.06 g/mol. Its IUPAC name is (3-propan-2-ylcyclopentyl)azanide;tungsten.
Molecular Properties
| Compound Name | (3-propan-2-ylcyclopentyl)azanide;tungsten |
| PubChem CID | 153472180 |
| Molecular Formula | C8H16NW- |
| Molecular Weight | 310.06 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (3-propan-2-ylcyclopentyl)azanide;tungsten |
| SMILES | CC(C)C1CCC([NH-])C1.[W] |
| InChI | InChI=1S/C8H16N.W/c1-6(2)7-3-4-8(9)5-7;/h6-9H,3-5H2,1-2H3;/q-1; |
| InChIKey | IVVUCNZRQPUWEO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.06 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3-propan-2-ylcyclopentyl)azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-ylcyclopentyl)azanide;tungsten?
The IUPAC name of (3-propan-2-ylcyclopentyl)azanide;tungsten (CID 153472180) is (3-propan-2-ylcyclopentyl)azanide;tungsten.
What is the SMILES notation for (3-propan-2-ylcyclopentyl)azanide;tungsten?
The canonical SMILES for (3-propan-2-ylcyclopentyl)azanide;tungsten is CC(C)C1CCC([NH-])C1.[W].
What is the InChIKey of (3-propan-2-ylcyclopentyl)azanide;tungsten?
The InChIKey is IVVUCNZRQPUWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N.W/c1-6(2)7-3-4-8(9)5-7;/h6-9H,3-5H2,1-2H3;/q-1;.
What are the key properties of (3-propan-2-ylcyclopentyl)azanide;tungsten?
(3-propan-2-ylcyclopentyl)azanide;tungsten has a molecular weight of 310.06 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-ylcyclopentyl)azanide;tungsten is sourced from PubChem (CID 153472180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).