C8H15I — CID 147316597
cis-(1S,3R)-1-iodo-3-propan-2-ylcyclopentane (PubChem CID 147316597) has the molecular formula C8H15I and a molecular weight of 238.11 g/mol. Its IUPAC name is cis-(1S,3R)-1-iodo-3-propan-2-ylcyclopentane.
| Compound Name | cis-(1S,3R)-1-iodo-3-propan-2-ylcyclopentane |
|---|---|
| PubChem CID | 147316597 |
| Molecular Formula | C8H15I |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | cis-(1S,3R)-1-iodo-3-propan-2-ylcyclopentane |
| SMILES | CC(C)[C@@H]1CC[C@H](I)C1 |
| InChI | InChI=1S/C8H15I/c1-6(2)7-3-4-8(9)5-7/h6-8H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | CYZILUMJAKSSPI-SFYZADRCSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|