C8H16IN — CID 167503310
(2R,4R)-2-iodo-4-propan-2-ylpiperidine (PubChem CID 167503310) has the molecular formula C8H16IN and a molecular weight of 253.13 g/mol. Its IUPAC name is (2R,4R)-2-iodo-4-propan-2-ylpiperidine.
| Compound Name | (2R,4R)-2-iodo-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 167503310 |
| Molecular Formula | C8H16IN |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | (2R,4R)-2-iodo-4-propan-2-ylpiperidine |
| SMILES | CC(C)[C@@H]1CCN[C@H](I)C1 |
| InChI | InChI=1S/C8H16IN/c1-6(2)7-3-4-10-8(9)5-7/h6-8,10H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | LGFZNZMQPHISMX-SFYZADRCSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|