C8H10N2O — CID 171484326
(E)-2-(3,4-diaminophenyl)ethenol (PubChem CID 171484326) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (E)-2-(3,4-diaminophenyl)ethenol.
| Compound Name | (E)-2-(3,4-diaminophenyl)ethenol |
|---|---|
| PubChem CID | 171484326 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (E)-2-(3,4-diaminophenyl)ethenol |
| SMILES | Nc1ccc(/C=C/O)cc1N |
| InChI | InChI=1S/C8H10N2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-5,11H,9-10H2/b4-3+ |
| InChIKey | XYIMOJCGJGHQSV-ONEGZZNKSA-N |
| XLogP | 1.38 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|